1. DISSOCIATION OF OH-ACIDS

 

1.1. Nonconjugated OH-acids

1.1.1. ROH-acid

1.1.1.1. Alcohols ROH

1.1.1.1.1. R = H

1.1.1.1.2. R = alkyl

1.1.1.1.3. R = alkyl substituted by halogen

1.1.1.1.3.1. R = alkyl substituted by F

1.1.1.1.3.2. R = alkyl substituted by Cl

1.1.1.1.3.3. R = alkyl substituted by F and Cl

1.1.1.1.4. R = alkyl substituted by phenyl

1.1.1.1.5. R = alkyl substituted by halogen and phenyl

1.1.1.1.6. R = alkyl substituted by pyridyl

1.1.1.1.7. R = alkyl substituted by OH-group

1.1.1.1.8. R = alkyl substituted by alkoxy-group

1.1.1.1.9. R = alkyl substituted by various functional group

1.1.1.2. Hydrated aldehydes RCH(OH)OH

1.1.1.3. Hydrated ketones R1R2C(OH)OH

1.1.1.4. Cyclohexanols

1.1.1.5. Phenols

1.1.1.5.1. Phenols with one substituent

1.1.1.5.1.1. R = H

1.1.1.5.1.2. R = alkyl

1.1.1.5.1.3. R = functional group

1.1.1.5.1.3.1. R = halogen

1.1.1.5.1.3.2. R = OX

1.1.1.5.1.3.3. R = COX

1.1.1.5.1.3.4. R = NX2

1.1.1.5.1.3.5. R = N+X3

1.1.1.5.1.3.6. R = CX=NX

1.1.1.5.1.3.7. R = CN

1.1.1.5.1.3.8. R = NO

1.1.1.5.1.3.9. R = NO2

1.1.1.5.1.3.10. R = SX

1.1.1.5.1.3.11. R = S+X2

1.1.1.5.1.3.12. R = SCN

1.1.1.5.1.3.13. R = S(O)X

1.1.1.5.1.3.14. R = SO2X

1.1.1.5.1.3.15. R = SO3-

1.1.1.5.1.3.16. R = SF5

1.1.1.5.1.3.17. R = PX2

1.1.1.5.1.3.18. R = P+X3

1.1.1.5.1.3.19. R = P(O)X2

1.1.1.5.1.3.20. R = PO32-

1.1.1.5.1.3.21. R = P(S)X2

1.1.1.5.1.3.22. R = AsO3H-

1.1.1.5.1.3.23. R = SiMe3

1.1.1.5.1.4. R = alkyl substituted by functional group

1.1.1.5.1.5. R = cycle

1.1.1.5.1.5.1. R = carbocycle

1.1.1.5.1.5.2. R = phenyl and substituted phenyl

1.1.1.5.1.5.3. R = heterocycle

 

1.1.1.5.1.6. R = cycles separated with bridge

1.1.1.5.1.6.1.      R = cycles separated with CH2, CH(COO-), CHPh, CMe2, CMePh, C(CF3)2, CPh2, CH=CH, C=C, CH(PO2H-)NHCH2, CH(PO32-)NHCH2, CH(PO2H-)NHCH2CH2NHCH(PO2H-), CH(PO32-)NHCH2CH2NHCH(PO32-)

 

1.1.1.5.1.6.2. R = cycles separated with S, SO, SO2, O, C(O)CH=CH, C(O)O(CH2)nOC(O), C(O)NH(CH2)nNHC(O)

 

1.1.1.5.1.6.3. R = cycles separated with CH=N, CH=NNH, CH=NSO2, CH=NN=C(SH)NH, C(N=NPh)=NNH, N=N, N=NCEt=NNH, NHN=, N=CH, =N+Me, N+Me=CH, N=CHNMe

 

1.1.1.5.2. Phenols with two substituents

1.1.1.5.2.1. R1 = OH, R2 = alkyl, functional group

1.1.1.5.2.2. R1 = OH, R2 = alkyl substituted by functional. group

1.1.1.5.2.3. R1 = OH, R2 = X(cycle)

1.1.1.5.2.4. R1, R2 = alkyl

1.1.1.5.2.5. R1 = Me, R2 = functional group, alkyl substituted by

functional group

1.1.1.5.2.6. R1 = Me, R2 = X(substituted phenyl)

1.1.1.5.2.7. R1 = Me, R2 = N=N(cycle)

1.1.1.5.2.8. R1 = alkyl, R2 = functional. group, alkyl substituted by

functional group

1.1.1.5.2.9. R1 = alkyl, R2 = X(substituted phenyl)

1.1.1.5.2.10. R1 = halogen, R2 = functional group, alkyl substituted

by functional group

1.1.1.5.2.11. R1 = halogen, R2 = X(substituted phenyl)

1.1.1.5.2.12. R1 = OMe, R2 = functional group

1.1.1.5.2.13. R1 = OMe, R2 = alkyl substituted by functional

group

1.1.1.5.2.14. R1 = OMe, R2 = X(cycle)

1.1.1.5.2.15. R1 = OMe, R2 = cycle

1.1.1.5.2.16. R1 = OEt, R2 = functional group

1.1.1.5.2.17. R1 = COX, R2 = functional group

1.1.1.5.2.18. R1 = COO-, R2 = X(substituted phenyl)

1.1.1.5.2.19. R1 = NH2, R2 = functional group

1.1.1.5.2.20. R1 = NH2, R2 = X(cycle)

1.1.1.5.2.21. R1 = CH=NX, R2 = N=N(substituted phenyl)

1.1.1.5.2.22. R1 = SO3-, R2 = X(cycle)

1.1.1.5.2.23. R1 = NO2, R2 = functional group

1.1.1.5.2.24. R1 = NO2, R2 = alkyl substituted by functional

group

1.1.1.5.2.25. R1 = NO2, R2 = X(cycle)

1.1.15.2.26. R1, R2 = various groups

1.1.1.5.2.27. R1 = N=N(cycle), R2 = functional group

1.1.1.5.2.28. R1 = heterocycle, R2 = Me, functional group

 

1.1.1.5.3. Phenols with three substituents

1.1.1.5.3.1. R1, R2, R3 = alkyl

1.1.1.5.3.2. R1, R2 = alkyl; R3 = functional group

1.1.1.5.3.3. R1, R2 = alkyl; R3 = X(cycle)

1.1.1.5.3.4. R1 = alkyl; R2, R3 = functional group

1.1.1.5.3.5. R1 = alkyl, R2 = functional group, R3 = X(cycle)

1.1.1.5.3.6. R1, R2 = halogen; R3 = functional group

1.1.1.5.3.7. R1, R2 = halogen; R3 = cycle or X(cycle)

1.1.1.5.3.8. R1, R2, R3 = various groups

1.1.1.5.3.9. R1, R2, R3 = OH

1.1.1.5.3.10. R1, R2 = various groups; R3 = cycle or X(cycle)

 

1.1.1.5.4. Phenols with four substituents

1.1.1.5.5. Phenols with five substituents

 

 

1.1.1.6. Naphtols

1.1.1.6 1. 1-Naphtols

1.1.1.6.1.1. 1-Naphtols with one substituent

1.1.1.6.1.1.1. R = H

1.1.1.6.1.1.2. R = various groups

1.1.1.6.1.1.3. R = heterocycle

1.1.1.6.1.1.4. R = N=N(cycle)

 

1.1.1.6.1.2. 1-Naphtols with two substituents

1.1.1.6.1.2.1. R1, R2 = various groups

1.1.1.6.1.2.2. R1 = SO3-, R2 = N=N(cycle)

1.1.1.6.1.2.3. R1 = COO-, R2 = N=N(cycle)

 

1.1.1.6.1.3. 1-Naphtols with three substituents

1.1.1.6.1.3.1. R1, R2, R3 = various groups

1.1.1.6.1.3.2. R1, R2 = SO3-; R3 = N=N(substituted phenyl)

 

1.1.1.6.1.4. 1-Naphtols with four substituents

1.1.1.6.1.4.1. R1, R2, R3, R4 = various groups

1.1.1.6.1.4.2. R1 = OH; R2, R3 = SO3-;

R4 = N=N(subst. phenyl)

 

1.1.1..6.1.5. 1-Naphtols with five substituents

 

1.1.1.6.2. 2-Naphtols

1.1.1.6.2.1. 2-Naphtols with one substituent

1.1.1.6.2.1.1. R = H

1.1.1.6.2.1.2. R = various groups

1.1.1.6.2.1.3. R = cycle

1.1.1.6.2.1.4. R = X(cycle)

 

1.1.1.6.2.2. 2-Naphtols with two substituents

1.1.1.6.2.2.1. R1, R2 = various groups

1.1.1.6.1.2.2. R1 = SO3-, R2 = N(substitututed phenyl)

 

1.1.1.6.2.3. 2-Naphtols with three substituents

1.1.1.6.2.3.1. R1, R2, R3 = various groups

1.1.1.6.2.3.2. R1, R2 = SO3-; R3 = N=N(substituted phenyl)

 

1.1.1.7. Carbocyclic OH-compounds

 

1.1.1.8. Oxycarbocyclic OH-compounds

(compounds contained CO-group in the cycle)

1.1.1.8 1. Mono-oxycarbocyclic OH-compounds

1.1.1.8.1.1. Three-membered rings

1.1.1.8.1.2. Four-membered rings

1.1.1.8.1.3. Five-membered rings

1.1.1.8.1.4. Six-membered rings

1.1.1.8.1.5. Seven-membered rings

1.1.1.8.2. Bi-oxycarbocyclic OH-compounds

1.1.1.8.3. Three-oxycarbocyclic OH-compounds

1.1.1.8.4. Four-oxycarbocyclic OH-compounds

 

1.1.1.9. Heterocyclic OH-compounds

1.1.1.9.1. N-heterocyclic OH-compounds

1.1.1.9.1.1. Monocyclic OH-compounds

1.1.1.9.1.2. Bicyclic OH-compounds

1.1.1.9.1.2.1. Hydroxy derivatives of quinoline

1.1.1.9.1.2.2. Hydroxy derivatives of other N-aromatic cycles

1.1.1.9.1.3. Threecyclic OH-compounds

1.1.1.9.1.4. Fourcyclic OH-compounds

 

1.1.1.9.2. O-heterocyclic OH-compounds

1.1.1.9.3. S-heterocyclic OH-compounds

1.1.1.9.4. As-heterocyclic OH-compounds

1.1.1.9.5. N,S-heterocyclic OH-compounds

1.1.1.9.6. N,O-heterocyclic OH-compounds

 

1.1.1.10. Oxyheterocyclic OH-compounds

(compounds contained in cycle CO-group)

1.1.1.10.1. O-heterocyclic OH-compounds contained CO-group

1.1.1.10.2. N-heterocyclic OH-compounds contained CO-group

1.1.1.10.3. N,O-heterocyclic OH-compounds contained CO-group

1.1.1.10.4. N,S-heterocyclic OH-compounds contained CO-group

 

1.1.1.11. Enols of the carbonic hydrazides RC(OH)=NNH2

 

1.1.1.12. Imides of the acylbenzsulfamides PhSO2N=C(OH)R

 

1.1.2. RCOOH-acids

 

1.1.2.1. Saturated aliphatic monocarboxylic acids

1.1.2.1.1. Unsubstituted acids (R = alkyl)

1.1.2.1.2. Substituted acids

1.1.2.1.2.1. Alkyl substituted by functional group

1.1.2.1.2.1.1. Alkyl substituted by halogen

1.1.2.1.2.1.1.1. Alkyl substituted by F

1.1.2.1.2.1.1.2. Alkyl substituted by Cl

1.1.2.1.2.1.1.3. Alkyl substituted by Br

1.1.2.1.2.1.1.4. Alkyl substituted by J

1.1.2.1.2.1.1.5. Alkyl substituted by F and Cl

 

1.1.2.1.2.1.2. Alkyl substituted by OH-group

1.1.2.1.2.1.3. Alkyl substituted by OX-group

1.1.2.1.2.1.3.1. Alkyl substituted by O(alkyl)

1.1.2.1.2.1.3.2. Alkyl substituted by O(cycle)

1.1.2.1.2.1.3.3. Alkyl substituted by O(phenyl)

 

1.1.2.1.2.1.4. Alkyl substituted by OOX-group (X = alkyl)

1.1.2.1.2.1.5. Alkyl substituted by OC(O)X-group (X = phenyl)

1.1.2.1.2.1.6. Alkyl substituted by COX-group

(X = alkyl or phenyl)

1.1.7.1.2.1.7. Alkyl substituted by COOX-group (X = alkyl)

1.1.2.1.2.1.8. Alkyl substituted by CONHX-group

1.1.2.1.2.1.9. Alkyl substituted by POX2-group

(X = alkyl, OR, phenyl)

1.1.2.1.2.1.10. Alkyl substituted by PSX2-group (X = phenyl)

1.1.2.1.2.1.11. Alkyl substituted by P+X3 group

(X = alkyl, phenyl)

1.1.2.1.2.1.12. Alkyl substituted by NXCOX-group

(X = H, alkyl, OR, cycle)

1.1.2.1.2.1.13. Alkyl substituted by CN-group

1.1.2.1.2.1.14. Alkyl substituted by NO2-group

1.1.2.1.2.1.15. Alkyl substituted by ONO2-group

1.1.2.1.2.1.16.  Alkyl substituted by SX-group

[X = H, alkyl, cycle, (CH2)nPh, COX, CN]

1.1.2.1.2.1.17.  Alkyl substituted by S(O)X-group

(X = phenyl, CF3)

1.1.2.1.2.1.18. Alkyl substituted by SO3- -group

1.1.2.1.2.1.19.  Alkyl substituted by SO2X-, OSO2X-groups

(X = phenyl, CF3)

1.1.2.1.2.1.20.  Alkyl substituted by SP(S)X1X2 -group

1.1.2.1.2.1.21.  Alkyl substituted by SiX3-group

(X = alkyl, phenyl, OSiX3)

1.1.2.1.2.1.22.    Alkyl substituted by GeX3-, SeX-groups

(X = alkyl, cycle)

1.1.2.1.2.1.23. Alkyl substituted by various groups

 

1.1.2.1.2.2. Alkyl substituted by carbocycle

1.1.2.1.2.2.1. Alkyl substituted by phenyl

1.1.2.1.2.2.1.1. R = CH2(substituted phenyl)

1.1.2.1.2.2.1.2. R = CH2CH2(substituted phenyl)

1.1.2.1.2.2.1.3. Other substitutions by phenyl

 

1.1.2.1.2.2.2. Alkyl substituted by other carbocycle

1.1.2.1.2.2.3. Alkyl substituted by OH-group and phenyl

1.1.2.1.2.2.4. Alkyl substituted by COOMe-group and phenyl

1.1.2.1.2.2.5. Alkyl substituted by functional group and phenyl

 

1.1.2.1.2.3. Alkyl substituted by heterocycle

1.1.2.1.2.3.1. Alkyl substituted by O-heterocycle

1.1.2.1.2.3.2. Alkyl substituted by N-heterocycle

1.1.2.1.2.3.3. Alkyl substituted by S-heterocycle

1.1.2.1.2.3.4. Alkyl substituted by N,O-heterocycle

1.1.2.1.2.3.5. Alkyl substituted by N,S-heterocycle

 

1.1.2.2. Saturated aliphatic dicarboxylic acids

1.1.2.2.1. Unsubstituted acids HOOC(CR1R2)nCOOH [R = H, alkyl]

1.1.2.2.1.1. Malonic acid and alkyl substituted malonic acids

HOOCR1R2COOH [R = H, alkyl]

1.1.2.2.1.2. Succinic acid and alkyl substituted succinic acids

HOOC(CR1R2) 2COOH [R = H, alkyl]

1.1.2.2.1.3.    Glutaric acid and alkyl substituted glutaric acids

HOOC(CR1R2)3COOH [R = H, alkyl]

1.1.2.2.1.4. Other unsubstituted saturated aliphatic dicarboxylic acids

HOOC(CR1R2)nCOOH [R = H, alkyl; n = 0, 48]

 

1.1.2.2.2. Substituted acids HOOC(CR1R2)2COOH [R = substituted alkyl]

1.1.2.2.2.1. Alkyl substituted by functional group

1.1.2.2.2.1.1. Alkyl substituted by halogen

1.1.2.2.2.1.2. Alkyl substituted by OH-group

1.1.2.2.2.1.3. Alkyl substituted by O(alkyl)-group

1.1.2.2.2.1.4. Alkyl substituted by OC(O)(alkyl)-group

1.1.2.2.2.1.5. Alkyl substituted by C(O)(phenyl)-group

1.1.2.2.2.1.6. Alkyl substituted by NHCO(phenyl)-group

1.1.2.2.2.1.7. Alkyl substituted by SH-group

 

1.1.2.2.2.2. Alkyl substituted by phenyl

1.1.2.2.2.3. Alkyl substituted by several various groups

 

1.1.2.2.3. Acids with bridging atoms and groups

1.1.2.2.3.1. Acids with heteroatomic bridge

HOOC(CR1R2)nX(CR3R4)nCOOH

[R = H, alkyl; X = heteroatom]

1.1.2.2.3.2. Acids with cyclic bridge

HOOC(CR1R2)nX(CR3R4)nCOOH

[R = H, alkyl; X = bivalent cycle]

1.1.2.2.3.3. Acids with heteroatomic and cyclic bridge

HOOC(CR R2)nX(CR3R4)nCOOH

[R = H, alkyl; X = heteroatom and bivalent cycle]

 

1.1.2.3. Saturated aliphatic tricarboxylic acids

1.1.2.3.1.      Unsubstituted acids HOOC(CR1R2)CR3(COOH)(CR4R5)nCOOH

[R = H, alkyl; n = 0,1]

1.1.2.3.2. Substituted acids

 

1.1.2.4. Saturated aliphatic tetracarboxylic acids

 

1.1.2.5. Unsaturated aliphatic monocarboxylic acids

1.1.2.5.1. Unsubstituted acids

1.1.2.5.2. Substituted acids

1.1.2.5.2.1.    Alkenyl substituted by functional group - RCOOH

(R = unsaturated alkyl substituted by functional group)

1.1.2.5.2.1.1. Alkenyl substituted by halogen

1.1.2.5.2.1.2.      Alkenyl substituted by OX-group

[X = alkyl, (substituted)phenyl]

1.1.2.5.2.1.3.      Alkenyl substituted by COX-group

[X = alkyl, (substituted)phenyl]

1.1.2.5.2.1.4. Alkenyl substituted by COOX-group (X = alkyl)

1.1.2.5.2.1.5. Alkenyl substituted by CONHPh-group

1.1.2.5.2.1.6. Alkenyl substituted by SX-group

1.1.2.5.2.1.7.      Alkenyl substituted by S(O)X-group

 

1.1.2.5.2.1.8. Alkenyl substituted by SO2X-group

1.1.2.5.2.1.9.      Alkenyl substituted by NO2-group

1.1.2.5.2.1.10.  Alkenyl substituted by SiX3-group

 

1.1.2.5.2.2.      Alkenyl substituted by phenyl RCOOH

(R = unsaturated alkyl substituted by phenyl)

1.1.2.5.2.2.1. R = CH=CH(substituted phenyl)

1.1.2.5.2.2.2.      R = CPh=CH(substituted phenyl)

1.1.2.5.2.2.3.      R = C(COOH)=CH(substituted phenyl)

1.1.4.5.2.2.4. R = C=C(substituted phenyl)

1.1.2.5.2.2.5. Other substitutions by phenyl

 

1.1.2.5.2.3. Alkenyl substituted by other carbocycle

1.1.2.5.2.4. Alkenyl substituted by heterocycle

1.1.2.5.2.5. Alkenyl substituted by functional groups and cycle

1.1.2.5.2.6. Alkenyl substituted by phenyl and cycle

 

1.1.2.6. Unsaturated aliphatic dicarboxylic acids

1.1.2.6.1. Unsubstituted acids

1.1.2.6.2. Substituted acids

 

1.1.2.7. Unsaturated aliphatic tricarboxylic acids

 

1.1.2.8. Carbocyclic carboxylic acids

1.1.2.8.1. Saturated carbocyclic carboxylic acids

1.1.2.8.1.1. Cyclopropanecarboxylic acids

1.1.2.8.1.1.1. Cyclopropanemonocarboxylic acids

1.1.2.8.1.1.2. Cyclopropanepolycarboxylic acids

 

1.1.2.8.1.2. Cyclobutanecarboxylic acids

1.1.2.8.1.2.1. Cyclobutanemonocarboxylic acids

1.1.2.8.1.2.2. Cyclobutanedicarboxylic acids

 

1.1.2.8.1.3. Cyclopentanecarboxylic acids

1.1.2.8.1.3.1. Cyclopentanemonocarboxylic acids

1.1.2.8.1.3.2. Cyclopentanepolycarboxylic acids

 

1.1.2.8.1.4. Cyclohexanecarboxylic acids

1.1.2.8.1.4.1. Cyclohexanemonocarboxylic acids

1.1.2.8.1.4.2. Cyclohexanepolycarboxylic acids

 

1.1.2.8.1.5. Other saturated carbocyclic monocarboxylic acids

 

1.1.2.8.2. Unsaturated carbocyclic carboxylic acids

1.1.2.8.2.1. Monocarboxylic acids

1.1.2.8.2.2. Dicarboxylic acids

 

 

1.1.2.8.3. Benzoic acids

1.1.2.8.3.1. Benzoic acids with one substituent

1.1.2.8.3.1.1. R = H

1.1.2.8.3.1.2. R = alkyl

1.1.2.8.3.1.3. R = functional group

1.1.2.8.3.1.3.1. R = halogen

1.1.2.8.3.1.3.2. R = OH

1.1.2.8.3.1.3.3. R = OX

1.1.2.8.3.1.3.4. R = OC(O)X

1.1.2.8.3.1.3.5. R = COX

1.1.2.8.3.1.3.6. R = COOX

1.1.2.8.3.1.3.7. R = CONHX

1.1.2.8.3.1.3.8. R = NHNH2

1.1.2.8.3.1.3.9. R = NHCOX

1.1.2 8 3.1.3.10. R = NHCSX

1.1.2.8.3.1.3.11. R = NHSO2X

1.1.2.8.3.1.3.12. R = N(SO2CF3) 2

1.1.2.8.3.1.3.13. R = N3

1.1.2.8.3.1.3.14. R = NCS

1.1.2.8.3.1.3.15. R = NO, NO2

1.1.2.8.3.1.3.16. R = N=NR, N=NCH(COX)2

1.1.2.8.3.1.3.17. R = NHN=C(COX)2

1.1.2.8.3.1.3.18. R = N=CMeCH=C(OH)Me

1.1.2.8.3.1.3.19. R = N=N(O)Ph, N(O)=NPh

1.1.2.8.3.1.3.20. R = CN

1.1.2.8.3.1.3.21. R = PX2, P+X3

1.1.2.8.3.1.3.22. R = POX2

1.1.2.8.3.1.3.23. R = P(O)(OX) 2

1.1.2.8.3.1.3.24. R = P(O)NMe2

1.1.2.8.3.1.3.25. R = PO3H-, OPO3H-

1.1.2.8.3.1.3.26. R = P(S)X2 , As(S)X2

1.1.2.8.3.1.3.27. R = AsX2

1.1.2.8.3.1.3.28. R = As(O)X2

1.1.2.8.3.1.3.29. R = SX, S+X2

1.1.2.8.3.1.3.30. R = S(O)X, SO2X, SO2-, SO3-

1.1.2.8.3.1.3.31. R = OSO2X

1.1.2.8.3.1.3.32. R = SF5

1.1.2.8.3.1.3.33. R = SeX

1.1.2.8.3.1.3.34. R = SiX3, GeX3 , SnX3

1.1.2.8.3.1.3.35. R = B(OH)2

 

1.1.2.8.3.1.4. R = alkyl substituted by functional group

1.1.2.8.3.1.4.1. Alkyl substituted by halogen

1.1.2.8.3.1.4.2.    Alkyl substituted by other functional

group

 

1.1.2.8.3.1.5. R = carbocycle

1.1.2.8.3.1.6. R = phenyl or substituted phenyl

1.1.2.8.3.1.6.1.    R = phenyl or subst. phenyl in ortho

position

1.1.2.8.3.1.6.2.    R = phenyl or subst. phenyl in meta

position

1.1.2.8.3.1.6.3.    R = phenyl or subst. phenyl in para

position

 

1.1.2.8.3.1.7. R = naphthyl

1.1.2.8.3.1.8. R = heterocycle

1.1.2.8.3.1.9. R = cycle separated with bridge

 

1.1.2.8.3.2. Benzoic acids with two substituents

1.1.2.8.3.2.1. R1 = alkyl, R2 = functional group

1.1.2.8.3.2.2. R1 = halogen, R2 = functional group or alkyl

substituted by functional group

1.1.2.8.3.2.3. R1 = NO2, R2 = N=N(cycle)

1.1.2.8.3.2.4. R1 = R2 = various groups

1.1.2.8.3.2.5. R1, R2 = various groups

 

1.1.2.8.3.3. Benzoic acids with three substituents

1.1.2.8.3.3.1. R1, R2 = OH; R3 = 3-adamantyl

1.1.2.8.3.3.2. R1 = OH, R2 = SO3-, R3 = N=N(cycle)

1.1.2.8.3.3.3. R1 = R2 = R3 = various groups

1.1.2.8.3.2.4. R1, R2, R3 = various groups

 

1.1.2.8.3.4. Benzoic acids with four substituents

1.1.2.8.3.5. Benzoic acids with five substituents

1.1.2.8.3.6. Aminobenzoic acids

1.1.2.8.3.6.1. R = NH2

1.1.2.8.3.6.2. R = NHX (X = alkyl or phenyl)

1.1.2.8.3.6.3.      R = NX1X2 or N+X2X2X3 (X = alkyl or phenyl)

1.1.2.8.3.6.4.      R = (CH2)nX1X2

 

1.1.2.8.3.7. Benzenepolycarboxylic acids

1.1.2.8.3.7.1. Dicarboxylic acids

1.1.2.8.3.7.2. Other polycarboxylic acids

 

1.1.2.8.4. Fused polycyclic carbocyclic carboxylic acids

1.1.2.8.4.1. Fused bicyclic carboxylic acids

1.1.2.8.4.1.1. Monocarboxylic acids

1.1.2.8.4.1.1.1. 1-Naphtoic acids

1.1.2.8.4.1.1.2. 2-Naphtoic acids

1.1.2.8.4.1.1.3. Other bicyclic monocarboxylic acids

 

1.1.2.8.4.1.2. Dicarboxylic acids

 

1.1.2.8.4.2. Fused tricyclic carboxylic acids

1.1.2.8.4.2.1. Monocarboxylic acids

1.1.2.8.4.2.2. Dicarboxylic acids

 

1.1.2.8.4.3. Fused fourcyclic carboxylic acids

 

1.1.2.8.5. Bridged hydrocarbon carboxylic acids

1.1.2.8.5.1. Bridged bicyclic carboxylic acids

            1.1.2.8.5.1.1. Monocarboxylic acids

1.1.2.8.5.1.1.1. Bicyclo[2,2,1]heptane (norbornane)

carboxylic acids

1.1.2.8.5.1.1.2. Bicyclo[2,2,1]hept-5-ene (norbornene)

carboxylic acids

1.1.2.8.5.1.1.3. Bicyclo[2,2,2]octane carboxylic acids

1.1.2.8.5.1.1.4. Other bicyclic systems

 

1.1.2.8.5.1.2. Dicarboxylic acids

1.1.2.8.5.1.2.1. Bicyclo[2,2,1]heptane (norbornane)

dicarboxylic acids

1.1.2.8.5.1.2.2. Bicyclo[2,2,1]hept-5-ene (norbornene)

dicarboxylic acids

1.1.2.8.5.1.2.3. Bicyclo[2,2,2]octane dicarboxylic acids

1.1.2.8.5.1.2.4. Other bicyclic systems

 

1.1.2.8.5.2. Bridged polycyclic carboxylic acids

 

1.1.2.9. Heterocyclic carboxylic acids

1.1.2.9.1. O-heterocyclic carboxylic acids

1.1.2.9.1.1. Monocyclic monocarboxylic acids

1.1.2.9.1.2. Monocyclic dicarboxylic acids

1.1.2.9.1.3. Polycyclic carboxylic acids

 

1.1.2.9.2. N-heterocyclic carboxylic acids

1.1.2.9.2.1. Monocyclic monocarboxylic acids

1.1.2.9.2.2. Monocyclic dicarboxylic acids

1.1.2.9.2.3. Polycyclic carboxylic acids

 

1.1.2.9.3. S-heterocyclic carboxylic acids

1.1.2.9.3.1. Monocyclic monocarboxylic acids

1.1.2.9.3.2. Monocyclic dicarboxylic acids

1.1.2.9.3.3. Polycyclic carboxylic acids

 

1.1.2.9.4. Se, Te-, As-heterocyclic carboxylic acids

1.1.2.9.5. N,O- and N,S-heterocyclic carboxylic acids

1.1.2.9.6. Bridged heterocyclic carboxylic acids

1.1.2.9.7. Heterocyclic carboxylic acids substituted by heterocycles

 

1.1.2.10. Various carboxylic acids

1.1.2.10.1. XCOCOOH (X = H, alkyl, functional group, phenyl)

1.1.2.10.2. HXCOOH (X = O, S)

1.1.2.10.3. XSO2COOH (X = alkyl)

1.1.2.10.4. X3SiCOOH (X = Me, phenyl)

1.1.2.10.5. X3GeCOOH (X = Me, phenyl)

 

 

1.1.3. R1R2P(O)OH-acids

1.1.3.1. Phosphinic acids R1R2P(O)OH

1.1.3.1.1. Dialkylphosphinic acids (R1 = R2 = alkyl)

1.1.3.1.2. Other phosphinic acids (R = H, alkyl, substituted alkyl, cycle)

 

1.1.3.2. Esters of alkylphosphonic acids R1(R2O)P(O)OH

1.1.3.3. Dialkylphosphoric acids (RO)2P(O)OH

 

1.1.3.4. S-alkyl alkyl(aryl)thiophosphonic acids R1(R2S)P(O)OH

 

1.1.3.5. Diarylphosphoric acids (RO)2P(O)OH

 

1.1.4. R1R2P(S)OH-acids

1.1.4.1. Thiophosphinic acids

1.1.4.1.1. Dialkylthiophosphinic acids (R1 = R2 = alkyl)

1.1.4.1.2. Other thiophosphinic acids (R = alkyl, cycle)

 

1.1.4.2. Esters of thiophosphonic acids R1(R2O)P(S)OH

 

1.1.4.3. Dialkyl(aryl)thiophosphoric acids (RO)2P(S)OH

 

1.1.5. R1R2P(Se)OH-acids (Organophosphorus seleno-acids)

 

1.1.6. RP(O)(OH)2-acids

1.1.6.1. Monophosphonic acids

1.1.6.1.1. R = H, alkyl

1.1.6.1.2.      R = OR (Esters of phosphoric acids;

R = alkyl, substituted alkyl, cycle)

1.1.6.1.3.      R = SR (S-substituted phosphorothioic acids; R = alkyl,

substituted alkyl)

1.1.6.1.4. R = other functional groups

1.1.6.1.5. R = substituted alkyl

1.1.6.1.6. R = cycle

1.1.6.1.7. R = pyridyl

 

1.1.6.2. Diphosphonic acids

 

1.1.6.3. Tetraphosphonic acids

 

1.1.6.4. Aminophosphonic acids

1.1.6.4.1. Aminoalkylphosphonic acids H3N+(CH2)nPO3H

1.1.6.4.2. Ethylenediaminephosphonic acids

HO3P(CH2)nN+R2CH2CH2N+R2(CH2)nPO3H

1.1.6.4.3. Other amino(alkyl)polyphosphonic acids

 

1.1.7. RSO3H-acids

1.1.7.1. Monosulfonic acids

1.1.7.1.1. R = alkyl, functional group, substituted alkyl

1.1.7.1.2. R = NH2 (aminosulfonic acids)

1.1.7.1.3. R = phenyl

1.1.7.1.4. R = naphthyl

1.1.7.1.5. R = other carbocycle

1.1.7.1.6. R = N-heterocycle

1.1.7.2. Disulfonic acids

 

1.1.8. RAsO3H2-acids (Arsonic acids)

1.1.8.1. R = H, OH, alkyl, substituted alkyl

1.1.8.2. R = cycle

 

1.1.9. R1C(O)N(OH)R2-acids

 

1.1.9.1. Hydroxamic acids - RC(O)NHOH

1.1.9.1.1. Monohydroxamic acids - RC(O)NHOH

1.1.9.1.1.1. R = H, NH2

1.1.9.1.1.2. R = C(O)NHSO2(phenyl)

1.1.9.1.1.3. R = alkyl

1.1.9.1.1.4. R = substituted alkyl

1.1.9.1.1.5. R = CH=CH(phenyl)

1.1.9.1.1.6. R = phenyl

1.1.9.1.1.7. R = other cycles

1.1.9.1.2. Dihydroxamic acids - HONHC(O)XC(O)NHOH (X = cycle)

 

1.1.9.2. N-substituted hydroxamic acids - RC(O)N(OH)R'

1.1.9.2.1.      R' = phenyl(substituted phenyl)

1.1.9.2.2. R' = alkyl

1.1.9.2.2.1. RCONMeOH

1.1.9.2.2.2. RCONBuOH

1.1.9.2.2.3. RCON(t-Bu)OH

1.1.9.2.3. R' = CH2(phenyl)

1.1.9.2.4. R' = cyclohexyl

 

 

1.2. Conjugated OH-acids (O+H-acids)

1.2.1. Conjugated acids of alcoholes and ethers

1.2.1.1. Conjugated acids of alcohols RO+H2

1.2.1.2. Conjugated acids of ethers R1R2O+H2

1.2.1.2.1. Conjugated acids of monoethers R1R2O+H2

1.2.1.2.2. Conjugated acids of polyethers R1OX(OR2)n . H+ (n = 1,2,3)

1.2.1.2.3. Conjugated acids of cyclic ethers

 

1.2.2. Conjugated acids of aldehydes and ketones

1.2.2.1. Conjugated acids of aldehydes RC(=O+H)H

1.2.2.2. Conjugated acids of ketones R1C(=O+H)R2

1.2.2.2.1. R1 = Me

1.2.2.2.2. R1 = alkyl

1.2.2.2.3. R1, R2 = phenyl and substituted phenyl

1.2.2.2.4. R1 = phenyl, R2 = alkyl(alkenyl) substituted by phenyl

1.2.2.2.5. R1 = phenyl

1.2.2.2.6. R1, R2 = various groups

1.2.2.2.7. Cyclic ketones

1.2.2.2.7.1. Carbocyclic ketones

1.2.2.2.7.1.1. Monocarbocyclic ketones

1.2.2.2.7.1.2. Polycarbocyclic ketones

1.2.2.2.7.2.    Carbocyclic diketones

1.2.2.2.7.3. Heterocyclic ketones

 

1.2.3. Conjugated acids of amides R1C(=O+H)NR2R3

1.2.3.1. RC(=O+H)NH2

1.2.3.1.1. R = H, alkyl, alkenyl, functional group, substituted alkyl

1.2.3.1.2. R = cycle

1.2.3.2. R1C(=O+H)NHR2

1.2.3.2.1. R2 = alkyl

1.2.3.2.2. R2 = functional group

1.2.3.2.3. R2 = cycle, alkyl substituted by phenyl

1.2.3.3. R1C(=O+H)NR2R3

1.2.3.4. Cyclic amides

 

1.2.4. Conjugated acids of carboxylic acids and esters R1C(=O+H)OH and

R1C(=O+H)OR2

1.2.4.1. Conjugated acids of carboxylic acids

1.2.4.1.1.      Conjugated acids of noncylic carboxylic acids

1.2.4.1.2. Conjugated acids of cyclic carboxylic acids

1.2.4.2. Conjugated acids of esters

 

1.2.5. Conjugated acids of nitrosocompounds RNO . H+

 

1.2.6. Conjugated acids of nitrocompounds RNO2 . H+

 

1.2.7. Conjugated acids of N-oxide

1.2.7.1. Conjugated acids of noncyclic N-oxides R1CH=N+(OH)R2

1.2.7.2. Conjugated acids of cyclic N-oxides

 

1.2.8. Conjugated acids of sulfoxides R1C(=S+H)R2

 

1.2.9. Conjugated acids of sulfones and sulfonic acids R1R2SO2 . H+ and

R1R2SO3H . H+

 

1.2.10.  Conjugated acids of organophosphorous compounds

1.2.10.1. Conjugated acids of organophosphinic acids and organophosphinates

R1R2P(=O+H)OH and R1R2P(=O+H)OR3

1.2.10.2. Conjugated acids of organophosphonic acids and organophosphates

RP(=O+H)(OH)2, R1P(=O+H)(OH)(OR2) and R1P(=O+H)(OR2)(OR3)

1.2.10.3. Conjugated acids of phosphine oxides

R1R2R3P(=O+H)

1.2.10.3.1. R3(=O+H)

1.2.10.3.2. (R1)2P(=O+H)NR2R3

1.2.10.3.3. R1P(=O+H)(NR2R3)2

1.2.10.3.4. P(=O+H)(NR1R2)3

1.2.10.3.5. R1R2P(=O+H)Ph

1.2.10.3.6. RP(=O+H)Ph2

1.2.10.3.7. (R1)2P(=O)XP(=O)(R2)2 . H+

1.2.10.3.8. R1R2P(=O)XC(=O)NR3R4 . H+

1.2.10.3.9. R1R2R3P(=O+H)

 

1.2.11. Conjugated acids of organoarsene compounds

1.2.11.1. Conjugated acids of organoarsinic acids and organoarsinates

R1R2As(=O+H)OH and R1R2As(=O+H)OR3

1.2.11.2. Conjugated acids of organoarsonic acids and organoarsonates

RAs(=O+H)(OH)2 and R1As(=O+H)(OR2)2

1.2.11.3. Conjugated acids of arsine oxides

R1R2R3(=O+H)

1.2.11.4. Conjugated acids of cyclic arsine oxides

 

1.2.12. Conjugated acids of stibene oxides R1R2R3Sb(=O+H)

 

1.2.13. Conjugated acids of selenide oxides R1R2Se(=O+H)